C20H18ClF3N2O2 — CID 112818151
1-[2-(4-chlorophenoxy)ethyl]-1-methyl-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]urea (PubChem CID 112818151) has the molecular formula C20H18ClF3N2O2 and a molecular weight of 410.82 g/mol. Its IUPAC name is 1-[2-(4-chlorophenoxy)ethyl]-1-methyl-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]urea.
| Compound Name | 1-[2-(4-chlorophenoxy)ethyl]-1-methyl-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]urea |
|---|---|
| PubChem CID | 112818151 |
| Molecular Formula | C20H18ClF3N2O2 |
| Molecular Weight | 410.82 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 1-[2-(4-chlorophenoxy)ethyl]-1-methyl-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]urea |
| SMILES | CN(CCOc1ccc(Cl)cc1)C(=O)NCC#Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H18ClF3N2O2/c1-26(12-13-28-18-9-7-17(21)8-10-18)19(27)25-11-3-5-15-4-2-6-16(14-15)20(22,23)24/h2,4,6-10,14H,11-13H2,1H3,(H,25,27) |
| InChIKey | KKIZVNKPTMZGES-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.82 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|