C17H19Cl3N2O4 — CID 112820830
morpholin-4-yl-[1-(2,3,5-trichloro-6-hydroxybenzoyl)piperidin-4-yl]methanone (PubChem CID 112820830) has the molecular formula C17H19Cl3N2O4 and a molecular weight of 421.71 g/mol. Its IUPAC name is morpholin-4-yl-[1-(2,3,5-trichloro-6-hydroxybenzoyl)piperidin-4-yl]methanone.
| Compound Name | morpholin-4-yl-[1-(2,3,5-trichloro-6-hydroxybenzoyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 112820830 |
| Molecular Formula | C17H19Cl3N2O4 |
| Molecular Weight | 421.71 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | morpholin-4-yl-[1-(2,3,5-trichloro-6-hydroxybenzoyl)piperidin-4-yl]methanone |
| SMILES | O=C(c1c(O)c(Cl)cc(Cl)c1Cl)N1CCC(C(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C17H19Cl3N2O4/c18-11-9-12(19)15(23)13(14(11)20)17(25)21-3-1-10(2-4-21)16(24)22-5-7-26-8-6-22/h9-10,23H,1-8H2 |
| InChIKey | CDFZBLQGYMGLBT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.71 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|