C21H29NO4 — CID 112821890
methyl 1-[(5-acetyl-2-ethoxyphenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate (PubChem CID 112821890) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is methyl 1-[(5-acetyl-2-ethoxyphenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate.
| Compound Name | methyl 1-[(5-acetyl-2-ethoxyphenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
|---|---|
| PubChem CID | 112821890 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | methyl 1-[(5-acetyl-2-ethoxyphenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
| SMILES | CCOc1ccc(C(C)=O)cc1CN1C(C(=O)OC)CC2CCCCC21 |
| InChI | InChI=1S/C21H29NO4/c1-4-26-20-10-9-15(14(2)23)11-17(20)13-22-18-8-6-5-7-16(18)12-19(22)21(24)25-3/h9-11,16,18-19H,4-8,12-13H2,1-3H3 |
| InChIKey | WZJZCNLITAPRFK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |