C22H23BrN2O4 — CID 112828718
N-[2-[[4-[(4-bromophenyl)methoxy]-3-methoxyphenyl]methylamino]ethyl]furan-2-carboxamide (PubChem CID 112828718) has the molecular formula C22H23BrN2O4 and a molecular weight of 459.34 g/mol. Its IUPAC name is N-[2-[[4-[(4-bromophenyl)methoxy]-3-methoxyphenyl]methylamino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[4-[(4-bromophenyl)methoxy]-3-methoxyphenyl]methylamino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 112828718 |
| Molecular Formula | C22H23BrN2O4 |
| Molecular Weight | 459.34 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | N-[2-[[4-[(4-bromophenyl)methoxy]-3-methoxyphenyl]methylamino]ethyl]furan-2-carboxamide |
| SMILES | COc1cc(CNCCNC(=O)c2ccco2)ccc1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C22H23BrN2O4/c1-27-21-13-17(14-24-10-11-25-22(26)20-3-2-12-28-20)6-9-19(21)29-15-16-4-7-18(23)8-5-16/h2-9,12-13,24H,10-11,14-15H2,1H3,(H,25,26) |
| InChIKey | DPHQZTAWPMXERG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 72.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.34 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|