C19H14F4N4O3 — CID 112831048
1-(4-fluorophenyl)-N-[(2-nitrophenyl)methyl]-N-(2,2,2-trifluoroethyl)pyrazole-3-carboxamide (PubChem CID 112831048) has the molecular formula C19H14F4N4O3 and a molecular weight of 422.34 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[(2-nitrophenyl)methyl]-N-(2,2,2-trifluoroethyl)pyrazole-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-[(2-nitrophenyl)methyl]-N-(2,2,2-trifluoroethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 112831048 |
| Molecular Formula | C19H14F4N4O3 |
| Molecular Weight | 422.34 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[(2-nitrophenyl)methyl]-N-(2,2,2-trifluoroethyl)pyrazole-3-carboxamide |
| SMILES | O=C(c1ccn(-c2ccc(F)cc2)n1)N(Cc1ccccc1[N+](=O)[O-])CC(F)(F)F |
| InChI | InChI=1S/C19H14F4N4O3/c20-14-5-7-15(8-6-14)26-10-9-16(24-26)18(28)25(12-19(21,22)23)11-13-3-1-2-4-17(13)27(29)30/h1-10H,11-12H2 |
| InChIKey | JVZVCRCXRHOOCS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.34 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|