C20H17F4N3O3 — CID 55762267
2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-[(2-nitrophenyl)methyl]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 55762267) has the molecular formula C20H17F4N3O3 and a molecular weight of 423.37 g/mol. Its IUPAC name is 2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-[(2-nitrophenyl)methyl]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-[(2-nitrophenyl)methyl]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 55762267 |
| Molecular Formula | C20H17F4N3O3 |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-[(2-nitrophenyl)methyl]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | Cc1[nH]c2ccc(F)cc2c1CC(=O)N(Cc1ccccc1[N+](=O)[O-])CC(F)(F)F |
| InChI | InChI=1S/C20H17F4N3O3/c1-12-15(16-8-14(21)6-7-17(16)25-12)9-19(28)26(11-20(22,23)24)10-13-4-2-3-5-18(13)27(29)30/h2-8,25H,9-11H2,1H3 |
| InChIKey | ILAHJXKJUHJYPS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 79.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|