C16H16ClF3N4O3 — CID 55923742
2-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-[(2-nitrophenyl)methyl]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 55923742) has the molecular formula C16H16ClF3N4O3 and a molecular weight of 404.78 g/mol. Its IUPAC name is 2-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-[(2-nitrophenyl)methyl]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-[(2-nitrophenyl)methyl]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 55923742 |
| Molecular Formula | C16H16ClF3N4O3 |
| Molecular Weight | 404.78 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 2-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-[(2-nitrophenyl)methyl]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | Cc1nn(CC(=O)N(Cc2ccccc2[N+](=O)[O-])CC(F)(F)F)c(C)c1Cl |
| InChI | InChI=1S/C16H16ClF3N4O3/c1-10-15(17)11(2)23(21-10)8-14(25)22(9-16(18,19)20)7-12-5-3-4-6-13(12)24(26)27/h3-6H,7-9H2,1-2H3 |
| InChIKey | FNGAVUJZYQYONJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.78 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|