C29H29O3PS — CID 11283205
methanesulfonate;triphenyl-[(Z)-4-phenylbut-2-enyl]phosphanium (PubChem CID 11283205) has the molecular formula C29H29O3PS and a molecular weight of 488.59 g/mol. Its IUPAC name is methanesulfonate;triphenyl-[(Z)-4-phenylbut-2-enyl]phosphanium.
| Compound Name | methanesulfonate;triphenyl-[(Z)-4-phenylbut-2-enyl]phosphanium |
|---|---|
| PubChem CID | 11283205 |
| Molecular Formula | C29H29O3PS |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | methanesulfonate;triphenyl-[(Z)-4-phenylbut-2-enyl]phosphanium |
| SMILES | C(=C\C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)\Cc1ccccc1.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C28H26P.CH4O3S/c1-5-15-25(16-6-1)17-13-14-24-29(26-18-7-2-8-19-26,27-20-9-3-10-21-27)28-22-11-4-12-23-28;1-5(2,3)4/h1-16,18-23H,17,24H2;1H3,(H,2,3,4)/q+1;/p-1/b14-13-; |
| InChIKey | MVGGVFZRLRSYPZ-HPWRNOGASA-M |
| XLogP | 4.94 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|