C25H34N8O3 — CID 11283318
N-[2-(2-aminoethoxy)ethoxymethyl]-4-[[4-(benzylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]amino]benzamide (PubChem CID 11283318) has the molecular formula C25H34N8O3 and a molecular weight of 494.60 g/mol. Its IUPAC name is N-[2-(2-aminoethoxy)ethoxymethyl]-4-[[4-(benzylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]amino]benzamide.
| Compound Name | N-[2-(2-aminoethoxy)ethoxymethyl]-4-[[4-(benzylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 11283318 |
| Molecular Formula | C25H34N8O3 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | N-[2-(2-aminoethoxy)ethoxymethyl]-4-[[4-(benzylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]amino]benzamide |
| SMILES | CC(C)Nc1nc(NCc2ccccc2)nc(Nc2ccc(C(=O)NCOCCOCCN)cc2)n1 |
| InChI | InChI=1S/C25H34N8O3/c1-18(2)29-24-31-23(27-16-19-6-4-3-5-7-19)32-25(33-24)30-21-10-8-20(9-11-21)22(34)28-17-36-15-14-35-13-12-26/h3-11,18H,12-17,26H2,1-2H3,(H,28,34)(H3,27,29,30,31,32,33) |
| InChIKey | QTZIRYYRLQLZGX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 148.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|