C25H23Cl2N5O2 — CID 11283340
2-[[2-(2-chlorophenyl)-3-(4-chlorophenyl)pyrazolo[4,3-d]pyrimidin-7-yl]amino]ethyl cyclopentanecarboxylate (PubChem CID 11283340) has the molecular formula C25H23Cl2N5O2 and a molecular weight of 496.40 g/mol. Its IUPAC name is 2-[[2-(2-chlorophenyl)-3-(4-chlorophenyl)pyrazolo[4,3-d]pyrimidin-7-yl]amino]ethyl cyclopentanecarboxylate.
| Compound Name | 2-[[2-(2-chlorophenyl)-3-(4-chlorophenyl)pyrazolo[4,3-d]pyrimidin-7-yl]amino]ethyl cyclopentanecarboxylate |
|---|---|
| PubChem CID | 11283340 |
| Molecular Formula | C25H23Cl2N5O2 |
| Molecular Weight | 496.40 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | 2-[[2-(2-chlorophenyl)-3-(4-chlorophenyl)pyrazolo[4,3-d]pyrimidin-7-yl]amino]ethyl cyclopentanecarboxylate |
| SMILES | O=C(OCCNc1ncnc2c(-c3ccc(Cl)cc3)n(-c3ccccc3Cl)nc12)C1CCCC1 |
| InChI | InChI=1S/C25H23Cl2N5O2/c26-18-11-9-16(10-12-18)23-21-22(31-32(23)20-8-4-3-7-19(20)27)24(30-15-29-21)28-13-14-34-25(33)17-5-1-2-6-17/h3-4,7-12,15,17H,1-2,5-6,13-14H2,(H,28,29,30) |
| InChIKey | XOLLSEHXEYNEGZ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.40 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|