C28H42O6S2 — CID 11284097
(2S,4S,6R,15S)-15-[(3R)-4-hydroxy-3-methyl-2-methylidenebutyl]-4-[2-[(4-methoxyphenyl)methoxy]ethyl]-5,16-dioxa-9,13-dithiadispiro[5.1.58.36]hexadecan-2-ol (PubChem CID 11284097) has the molecular formula C28H42O6S2 and a molecular weight of 538.77 g/mol. Its IUPAC name is (2S,4S,6R,15S)-15-[(3R)-4-hydroxy-3-methyl-2-methylidenebutyl]-4-[2-[(4-methoxyphenyl)methoxy]ethyl]-5,16-dioxa-9,13-dithiadispiro[5.1.58.36]hexadecan-2-ol.
| Compound Name | (2S,4S,6R,15S)-15-[(3R)-4-hydroxy-3-methyl-2-methylidenebutyl]-4-[2-[(4-methoxyphenyl)methoxy]ethyl]-5,16-dioxa-9,13-dithiadispiro[5.1.58.36]hexadecan-2-ol |
|---|---|
| PubChem CID | 11284097 |
| Molecular Formula | C28H42O6S2 |
| Molecular Weight | 538.77 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | (2S,4S,6R,15S)-15-[(3R)-4-hydroxy-3-methyl-2-methylidenebutyl]-4-[2-[(4-methoxyphenyl)methoxy]ethyl]-5,16-dioxa-9,13-dithiadispiro[5.1.58.36]hexadecan-2-ol |
| SMILES | C=C(C[C@H]1CC2(C[C@@]3(C[C@@H](O)C[C@H](CCOCc4ccc(OC)cc4)O3)O1)SCCCS2)[C@@H](C)CO |
| InChI | InChI=1S/C28H42O6S2/c1-20(21(2)17-29)13-26-16-28(35-11-4-12-36-28)19-27(34-26)15-23(30)14-25(33-27)9-10-32-18-22-5-7-24(31-3)8-6-22/h5-8,21,23,25-26,29-30H,1,4,9-19H2,2-3H3/t21-,23-,25-,26-,27+/m0/s1 |
| InChIKey | YRVHQFQWKDWCFN-ZNNHMPJGSA-N |
| XLogP | 5.16 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.77 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|