C29H37BrO8 — CID 11039237
[(2R,4S,6R,8S,10S)-8-[2-[(2-bromophenyl)methoxy]ethyl]-10-hydroxy-2-[(4-methoxyphenyl)methoxymethyl]-1,7-dioxaspiro[5.5]undecan-4-yl] acetate (PubChem CID 11039237) has the molecular formula C29H37BrO8 and a molecular weight of 593.51 g/mol. Its IUPAC name is [(2R,4S,6R,8S,10S)-8-[2-[(2-bromophenyl)methoxy]ethyl]-10-hydroxy-2-[(4-methoxyphenyl)methoxymethyl]-1,7-dioxaspiro[5.5]undecan-4-yl] acetate.
| Compound Name | [(2R,4S,6R,8S,10S)-8-[2-[(2-bromophenyl)methoxy]ethyl]-10-hydroxy-2-[(4-methoxyphenyl)methoxymethyl]-1,7-dioxaspiro[5.5]undecan-4-yl] acetate |
|---|---|
| PubChem CID | 11039237 |
| Molecular Formula | C29H37BrO8 |
| Molecular Weight | 593.51 g/mol |
| Exact Mass | 592.17 |
| IUPAC Name | [(2R,4S,6R,8S,10S)-8-[2-[(2-bromophenyl)methoxy]ethyl]-10-hydroxy-2-[(4-methoxyphenyl)methoxymethyl]-1,7-dioxaspiro[5.5]undecan-4-yl] acetate |
| SMILES | COc1ccc(COC[C@H]2C[C@H](OC(C)=O)C[C@@]3(C[C@@H](O)C[C@H](CCOCc4ccccc4Br)O3)O2)cc1 |
| InChI | InChI=1S/C29H37BrO8/c1-20(31)36-26-14-27(19-35-17-21-7-9-24(33-2)10-8-21)38-29(16-26)15-23(32)13-25(37-29)11-12-34-18-22-5-3-4-6-28(22)30/h3-10,23,25-27,32H,11-19H2,1-2H3/t23-,25-,26-,27+,29+/m0/s1 |
| InChIKey | SORTUHOGQCUXSX-ZTPIVRPASA-N |
| XLogP | 4.93 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.51 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|