C33H47BrO8Si — CID 11082950
(2R,6R,8S,10S)-8-[2-[(2-bromophenyl)methoxy]ethyl]-2-[(4-methoxyphenyl)methoxymethyl]-10-(2-trimethylsilylethoxymethoxy)-1,7-dioxaspiro[5.5]undecan-4-one (PubChem CID 11082950) has the molecular formula C33H47BrO8Si and a molecular weight of 679.72 g/mol. Its IUPAC name is (2R,6R,8S,10S)-8-[2-[(2-bromophenyl)methoxy]ethyl]-2-[(4-methoxyphenyl)methoxymethyl]-10-(2-trimethylsilylethoxymethoxy)-1,7-dioxaspiro[5.5]undecan-4-one.
| Compound Name | (2R,6R,8S,10S)-8-[2-[(2-bromophenyl)methoxy]ethyl]-2-[(4-methoxyphenyl)methoxymethyl]-10-(2-trimethylsilylethoxymethoxy)-1,7-dioxaspiro[5.5]undecan-4-one |
|---|---|
| PubChem CID | 11082950 |
| Molecular Formula | C33H47BrO8Si |
| Molecular Weight | 679.72 g/mol |
| Exact Mass | 678.22 |
| IUPAC Name | (2R,6R,8S,10S)-8-[2-[(2-bromophenyl)methoxy]ethyl]-2-[(4-methoxyphenyl)methoxymethyl]-10-(2-trimethylsilylethoxymethoxy)-1,7-dioxaspiro[5.5]undecan-4-one |
| SMILES | COc1ccc(COC[C@H]2CC(=O)C[C@@]3(C[C@@H](OCOCC[Si](C)(C)C)C[C@H](CCOCc4ccccc4Br)O3)O2)cc1 |
| InChI | InChI=1S/C33H47BrO8Si/c1-36-28-11-9-25(10-12-28)21-39-23-31-17-27(35)19-33(42-31)20-30(40-24-38-15-16-43(2,3)4)18-29(41-33)13-14-37-22-26-7-5-6-8-32(26)34/h5-12,29-31H,13-24H2,1-4H3/t29-,30-,31+,33-/m0/s1 |
| InChIKey | LZJPBYVGWQHRIO-YUPAOTDASA-N |
| XLogP | 6.90 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.72 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|