C29H38O7 — CID 177403690
(4S,7S,9E)-16-methoxy-6-(methoxymethoxy)-4-[2-[(4-methoxyphenyl)methoxy]ethyl]-7-methyl-3-oxabicyclo[10.4.0]hexadeca-1(12),9,13,15-tetraen-2-one (PubChem CID 177403690) has the molecular formula C29H38O7 and a molecular weight of 498.62 g/mol. Its IUPAC name is (4S,7S,9E)-16-methoxy-6-(methoxymethoxy)-4-[2-[(4-methoxyphenyl)methoxy]ethyl]-7-methyl-3-oxabicyclo[10.4.0]hexadeca-1(12),9,13,15-tetraen-2-one.
| Compound Name | (4S,7S,9E)-16-methoxy-6-(methoxymethoxy)-4-[2-[(4-methoxyphenyl)methoxy]ethyl]-7-methyl-3-oxabicyclo[10.4.0]hexadeca-1(12),9,13,15-tetraen-2-one |
|---|---|
| PubChem CID | 177403690 |
| Molecular Formula | C29H38O7 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | (4S,7S,9E)-16-methoxy-6-(methoxymethoxy)-4-[2-[(4-methoxyphenyl)methoxy]ethyl]-7-methyl-3-oxabicyclo[10.4.0]hexadeca-1(12),9,13,15-tetraen-2-one |
| SMILES | COCOC1C[C@H](CCOCc2ccc(OC)cc2)OC(=O)c2c(cccc2OC)C/C=C/C[C@@H]1C |
| InChI | InChI=1S/C29H38O7/c1-21-8-5-6-9-23-10-7-11-26(33-4)28(23)29(30)36-25(18-27(21)35-20-31-2)16-17-34-19-22-12-14-24(32-3)15-13-22/h5-7,10-15,21,25,27H,8-9,16-20H2,1-4H3/b6-5+/t21-,25-,27?/m0/s1 |
| InChIKey | CBCNRTLFKUXYAT-QCCBPOGKSA-N |
| XLogP | 5.35 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|