C16H15Cl3N2O4S — CID 112842593
N-[2-(benzylsulfamoyl)ethyl]-2,3,5-trichloro-6-hydroxybenzamide (PubChem CID 112842593) has the molecular formula C16H15Cl3N2O4S and a molecular weight of 437.73 g/mol. Its IUPAC name is N-[2-(benzylsulfamoyl)ethyl]-2,3,5-trichloro-6-hydroxybenzamide.
| Compound Name | N-[2-(benzylsulfamoyl)ethyl]-2,3,5-trichloro-6-hydroxybenzamide |
|---|---|
| PubChem CID | 112842593 |
| Molecular Formula | C16H15Cl3N2O4S |
| Molecular Weight | 437.73 g/mol |
| Exact Mass | 435.98 |
| IUPAC Name | N-[2-(benzylsulfamoyl)ethyl]-2,3,5-trichloro-6-hydroxybenzamide |
| SMILES | O=C(NCCS(=O)(=O)NCc1ccccc1)c1c(O)c(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C16H15Cl3N2O4S/c17-11-8-12(18)15(22)13(14(11)19)16(23)20-6-7-26(24,25)21-9-10-4-2-1-3-5-10/h1-5,8,21-22H,6-7,9H2,(H,20,23) |
| InChIKey | HKVMBAGKHCJWQE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.73 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|