C19H17Cl2N3O5S — CID 55795473
N-[2-(benzylsulfamoyl)ethyl]-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 55795473) has the molecular formula C19H17Cl2N3O5S and a molecular weight of 470.33 g/mol. Its IUPAC name is N-[2-(benzylsulfamoyl)ethyl]-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-[2-(benzylsulfamoyl)ethyl]-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 55795473 |
| Molecular Formula | C19H17Cl2N3O5S |
| Molecular Weight | 470.33 g/mol |
| Exact Mass | 469.03 |
| IUPAC Name | N-[2-(benzylsulfamoyl)ethyl]-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | O=C(CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O)NCCS(=O)(=O)NCc1ccccc1 |
| InChI | InChI=1S/C19H17Cl2N3O5S/c20-15-8-13-14(9-16(15)21)19(27)24(18(13)26)11-17(25)22-6-7-30(28,29)23-10-12-4-2-1-3-5-12/h1-5,8-9,23H,6-7,10-11H2,(H,22,25) |
| InChIKey | OJTUBKVLEGPEJN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|