C13H11F17N2O2 — CID 11284260
2-aminooxy-N-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)acetamide (PubChem CID 11284260) has the molecular formula C13H11F17N2O2 and a molecular weight of 550.21 g/mol. Its IUPAC name is 2-aminooxy-N-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)acetamide.
| Compound Name | 2-aminooxy-N-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)acetamide |
|---|---|
| PubChem CID | 11284260 |
| Molecular Formula | C13H11F17N2O2 |
| Molecular Weight | 550.21 g/mol |
| Exact Mass | 550.05 |
| IUPAC Name | 2-aminooxy-N-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)acetamide |
| SMILES | NOCC(=O)NCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H11F17N2O2/c14-6(15,2-1-3-32-5(33)4-34-31)7(16,17)8(18,19)9(20,21)10(22,23)11(24,25)12(26,27)13(28,29)30/h1-4,31H2,(H,32,33) |
| InChIKey | MIOJOGLHEIRDPY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.21 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|