C23H30F17NO6Si — CID 122389672
3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl 4-oxo-4-(3-triethoxysilylpropylamino)butanoate (PubChem CID 122389672) has the molecular formula C23H30F17NO6Si and a molecular weight of 767.55 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl 4-oxo-4-(3-triethoxysilylpropylamino)butanoate.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl 4-oxo-4-(3-triethoxysilylpropylamino)butanoate |
|---|---|
| PubChem CID | 122389672 |
| Molecular Formula | C23H30F17NO6Si |
| Molecular Weight | 767.55 g/mol |
| Exact Mass | 767.16 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl 4-oxo-4-(3-triethoxysilylpropylamino)butanoate |
| SMILES | CCO[Si](CCCNC(=O)CCC(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(OCC)OCC |
| InChI | InChI=1S/C23H30F17NO6Si/c1-4-45-48(46-5-2,47-6-3)13-7-11-41-14(42)8-9-15(43)44-12-10-16(24,25)17(26,27)18(28,29)19(30,31)20(32,33)21(34,35)22(36,37)23(38,39)40/h4-13H2,1-3H3,(H,41,42) |
| InChIKey | NZVWPLPQLMDMBL-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.55 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|