C18H15BrN2O4S — CID 112844733
5-bromo-N-methyl-N-[2-[(4-methyl-2-oxochromen-7-yl)amino]-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 112844733) has the molecular formula C18H15BrN2O4S and a molecular weight of 435.30 g/mol. Its IUPAC name is 5-bromo-N-methyl-N-[2-[(4-methyl-2-oxochromen-7-yl)amino]-2-oxoethyl]thiophene-2-carboxamide.
| Compound Name | 5-bromo-N-methyl-N-[2-[(4-methyl-2-oxochromen-7-yl)amino]-2-oxoethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 112844733 |
| Molecular Formula | C18H15BrN2O4S |
| Molecular Weight | 435.30 g/mol |
| Exact Mass | 433.99 |
| IUPAC Name | 5-bromo-N-methyl-N-[2-[(4-methyl-2-oxochromen-7-yl)amino]-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)CN(C)C(=O)c3ccc(Br)s3)ccc12 |
| InChI | InChI=1S/C18H15BrN2O4S/c1-10-7-17(23)25-13-8-11(3-4-12(10)13)20-16(22)9-21(2)18(24)14-5-6-15(19)26-14/h3-8H,9H2,1-2H3,(H,20,22) |
| InChIKey | HHMDMPAADSQXJP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.30 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|