C38H50N2O13 — CID 11285627
(15E,28Z)-15,28-bis[[4-(dimethylamino)phenyl]methylidene]-1,4,7,10,13,17,20,23,26-nonaoxacyclononacosane-14,16,27,29-tetrone (PubChem CID 11285627) has the molecular formula C38H50N2O13 and a molecular weight of 742.82 g/mol. Its IUPAC name is (15E,28Z)-15,28-bis[[4-(dimethylamino)phenyl]methylidene]-1,4,7,10,13,17,20,23,26-nonaoxacyclononacosane-14,16,27,29-tetrone.
| Compound Name | (15E,28Z)-15,28-bis[[4-(dimethylamino)phenyl]methylidene]-1,4,7,10,13,17,20,23,26-nonaoxacyclononacosane-14,16,27,29-tetrone |
|---|---|
| PubChem CID | 11285627 |
| Molecular Formula | C38H50N2O13 |
| Molecular Weight | 742.82 g/mol |
| Exact Mass | 742.33 |
| IUPAC Name | (15E,28Z)-15,28-bis[[4-(dimethylamino)phenyl]methylidene]-1,4,7,10,13,17,20,23,26-nonaoxacyclononacosane-14,16,27,29-tetrone |
| SMILES | CN(C)c1ccc(/C=C2/C(=O)OCCOCCOCCOCCOC(=O)/C(=C\c3ccc(N(C)C)cc3)C(=O)OCCOCCOCCOC2=O)cc1 |
| InChI | InChI=1S/C38H50N2O13/c1-39(2)31-9-5-29(6-10-31)27-33-35(41)50-23-19-46-15-13-45-14-16-47-20-24-51-36(42)34(28-30-7-11-32(12-8-30)40(3)4)38(44)53-26-22-49-18-17-48-21-25-52-37(33)43/h5-12,27-28H,13-26H2,1-4H3/b33-27-,34-28+ |
| InChIKey | DPZITZKOLPCJEM-DENOHBPFSA-N |
| XLogP | 2.56 |
| TPSA | 157.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.82 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|