C11H13ClO2 — CID 11287323
(E,2S)-4-(2-chlorophenyl)-2-methylbut-3-ene-1,2-diol (PubChem CID 11287323) has the molecular formula C11H13ClO2 and a molecular weight of 212.68 g/mol. Its IUPAC name is (E,2S)-4-(2-chlorophenyl)-2-methylbut-3-ene-1,2-diol.
| Compound Name | (E,2S)-4-(2-chlorophenyl)-2-methylbut-3-ene-1,2-diol |
|---|---|
| PubChem CID | 11287323 |
| Molecular Formula | C11H13ClO2 |
| Molecular Weight | 212.68 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | (E,2S)-4-(2-chlorophenyl)-2-methylbut-3-ene-1,2-diol |
| SMILES | C[C@](O)(/C=C/c1ccccc1Cl)CO |
| InChI | InChI=1S/C11H13ClO2/c1-11(14,8-13)7-6-9-4-2-3-5-10(9)12/h2-7,13-14H,8H2,1H3/b7-6+/t11-/m0/s1 |
| InChIKey | NATQVHMARORLKX-MLRMMBSGSA-N |
| XLogP | 2.10 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.68 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |