C13H18N2OS — CID 11288167
2-[(2R,3S)-1-[(R)-tert-butylsulfinyl]-3-ethenylaziridin-2-yl]pyridine (PubChem CID 11288167) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is 2-[(2R,3S)-1-[(R)-tert-butylsulfinyl]-3-ethenylaziridin-2-yl]pyridine.
| Compound Name | 2-[(2R,3S)-1-[(R)-tert-butylsulfinyl]-3-ethenylaziridin-2-yl]pyridine |
|---|---|
| PubChem CID | 11288167 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 2-[(2R,3S)-1-[(R)-tert-butylsulfinyl]-3-ethenylaziridin-2-yl]pyridine |
| SMILES | C=C[C@H]1[C@H](c2ccccn2)N1[S@](=O)C(C)(C)C |
| InChI | InChI=1S/C13H18N2OS/c1-5-11-12(10-8-6-7-9-14-10)15(11)17(16)13(2,3)4/h5-9,11-12H,1H2,2-4H3/t11-,12-,15?,17+/m0/s1 |
| InChIKey | QTSJJEPFGGXYTO-JEAGBWRXSA-N |
| XLogP | 2.46 |
| TPSA | 32.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|