C9H9NO — CID 93493906
2-[(2S,3R)-3-ethenyloxiran-2-yl]pyridine (PubChem CID 93493906) has the molecular formula C9H9NO and a molecular weight of 147.18 g/mol. Its IUPAC name is 2-[(2S,3R)-3-ethenyloxiran-2-yl]pyridine.
| Compound Name | 2-[(2S,3R)-3-ethenyloxiran-2-yl]pyridine |
|---|---|
| PubChem CID | 93493906 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | 2-[(2S,3R)-3-ethenyloxiran-2-yl]pyridine |
| SMILES | C=C[C@H]1O[C@H]1c1ccccn1 |
| InChI | InChI=1S/C9H9NO/c1-2-8-9(11-8)7-5-3-4-6-10-7/h2-6,8-9H,1H2/t8-,9+/m1/s1 |
| InChIKey | KQZCYCFEWMAJBR-BDAKNGLRSA-N |
| XLogP | 1.71 |
| TPSA | 25.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|