C8H8N2O — CID 98070956
(2R)-2-pyridin-2-yl-2,3-dihydro-1,3-oxazole (PubChem CID 98070956) has the molecular formula C8H8N2O and a molecular weight of 148.16 g/mol. Its IUPAC name is (2R)-2-pyridin-2-yl-2,3-dihydro-1,3-oxazole.
| Compound Name | (2R)-2-pyridin-2-yl-2,3-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 98070956 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | (2R)-2-pyridin-2-yl-2,3-dihydro-1,3-oxazole |
| SMILES | C1=CO[C@H](c2ccccn2)N1 |
| InChI | InChI=1S/C8H8N2O/c1-2-4-9-7(3-1)8-10-5-6-11-8/h1-6,8,10H/t8-/m1/s1 |
| InChIKey | JXDPSRJJHHTGQW-MRVPVSSYSA-N |
| XLogP | 1.17 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |