C7H7N3S — CID 19849196
5-pyridin-2-yl-2,3-dihydro-1,3,4-thiadiazole (PubChem CID 19849196) has the molecular formula C7H7N3S and a molecular weight of 165.22 g/mol. Its IUPAC name is 5-pyridin-2-yl-2,3-dihydro-1,3,4-thiadiazole.
| Compound Name | 5-pyridin-2-yl-2,3-dihydro-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 19849196 |
| Molecular Formula | C7H7N3S |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | 5-pyridin-2-yl-2,3-dihydro-1,3,4-thiadiazole |
| SMILES | c1ccc(C2=NNCS2)nc1 |
| InChI | InChI=1S/C7H7N3S/c1-2-4-8-6(3-1)7-10-9-5-11-7/h1-4,9H,5H2 |
| InChIKey | AZEUMXILAGTGDU-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |