C19H32OSi — CID 11289704
[(3aS,6R,7aR)-3a-methyl-6-prop-1-en-2-yl-1,6,7,7a-tetrahydroinden-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11289704) has the molecular formula C19H32OSi and a molecular weight of 304.55 g/mol. Its IUPAC name is [(3aS,6R,7aR)-3a-methyl-6-prop-1-en-2-yl-1,6,7,7a-tetrahydroinden-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aS,6R,7aR)-3a-methyl-6-prop-1-en-2-yl-1,6,7,7a-tetrahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11289704 |
| Molecular Formula | C19H32OSi |
| Molecular Weight | 304.55 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | [(3aS,6R,7aR)-3a-methyl-6-prop-1-en-2-yl-1,6,7,7a-tetrahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=C(C)[C@H]1C=C(O[Si](C)(C)C(C)(C)C)[C@]2(C)C=CC[C@@H]2C1 |
| InChI | InChI=1S/C19H32OSi/c1-14(2)15-12-16-10-9-11-19(16,6)17(13-15)20-21(7,8)18(3,4)5/h9,11,13,15-16H,1,10,12H2,2-8H3/t15-,16-,19-/m1/s1 |
| InChIKey | SBSFNYQYWDZAJE-GPMSIDNRSA-N |
| XLogP | 6.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.55 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|