C18H18N4O2 — CID 11290223
1-(1H-indazol-4-yl)-3-(5-methoxy-2,3-dihydro-1H-inden-1-yl)urea (PubChem CID 11290223) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is 1-(1H-indazol-4-yl)-3-(5-methoxy-2,3-dihydro-1H-inden-1-yl)urea.
| Compound Name | 1-(1H-indazol-4-yl)-3-(5-methoxy-2,3-dihydro-1H-inden-1-yl)urea |
|---|---|
| PubChem CID | 11290223 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 1-(1H-indazol-4-yl)-3-(5-methoxy-2,3-dihydro-1H-inden-1-yl)urea |
| SMILES | COc1ccc2c(c1)CCC2NC(=O)Nc1cccc2[nH]ncc12 |
| InChI | InChI=1S/C18H18N4O2/c1-24-12-6-7-13-11(9-12)5-8-16(13)21-18(23)20-15-3-2-4-17-14(15)10-19-22-17/h2-4,6-7,9-10,16H,5,8H2,1H3,(H,19,22)(H2,20,21,23) |
| InChIKey | ZBISBOUCIVCJOF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |