C25H25N5O2 — CID 11669102
1-(1-benzyl-6-methoxy-3,4-dihydro-2H-quinolin-4-yl)-3-(1H-indazol-4-yl)urea (PubChem CID 11669102) has the molecular formula C25H25N5O2 and a molecular weight of 427.51 g/mol. Its IUPAC name is 1-(1-benzyl-6-methoxy-3,4-dihydro-2H-quinolin-4-yl)-3-(1H-indazol-4-yl)urea.
| Compound Name | 1-(1-benzyl-6-methoxy-3,4-dihydro-2H-quinolin-4-yl)-3-(1H-indazol-4-yl)urea |
|---|---|
| PubChem CID | 11669102 |
| Molecular Formula | C25H25N5O2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 1-(1-benzyl-6-methoxy-3,4-dihydro-2H-quinolin-4-yl)-3-(1H-indazol-4-yl)urea |
| SMILES | COc1ccc2c(c1)C(NC(=O)Nc1cccc3[nH]ncc13)CCN2Cc1ccccc1 |
| InChI | InChI=1S/C25H25N5O2/c1-32-18-10-11-24-19(14-18)22(12-13-30(24)16-17-6-3-2-4-7-17)28-25(31)27-21-8-5-9-23-20(21)15-26-29-23/h2-11,14-15,22H,12-13,16H2,1H3,(H,26,29)(H2,27,28,31) |
| InChIKey | AYMSYYHWAONOKI-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|