C21H23N5O3 — CID 11696849
1-(1H-indazol-4-yl)-3-(8-morpholin-4-yl-3,4-dihydro-2H-chromen-4-yl)urea (PubChem CID 11696849) has the molecular formula C21H23N5O3 and a molecular weight of 393.45 g/mol. Its IUPAC name is 1-(1H-indazol-4-yl)-3-(8-morpholin-4-yl-3,4-dihydro-2H-chromen-4-yl)urea.
| Compound Name | 1-(1H-indazol-4-yl)-3-(8-morpholin-4-yl-3,4-dihydro-2H-chromen-4-yl)urea |
|---|---|
| PubChem CID | 11696849 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 1-(1H-indazol-4-yl)-3-(8-morpholin-4-yl-3,4-dihydro-2H-chromen-4-yl)urea |
| SMILES | O=C(Nc1cccc2[nH]ncc12)NC1CCOc2c1cccc2N1CCOCC1 |
| InChI | InChI=1S/C21H23N5O3/c27-21(23-16-4-2-5-18-15(16)13-22-25-18)24-17-7-10-29-20-14(17)3-1-6-19(20)26-8-11-28-12-9-26/h1-6,13,17H,7-12H2,(H,22,25)(H2,23,24,27) |
| InChIKey | DRKFVZNNQBSDBF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |