C18H15F3N4O3 — CID 11654024
1-(1H-indazol-4-yl)-3-[7-(trifluoromethoxy)-3,4-dihydro-2H-chromen-4-yl]urea (PubChem CID 11654024) has the molecular formula C18H15F3N4O3 and a molecular weight of 392.34 g/mol. Its IUPAC name is 1-(1H-indazol-4-yl)-3-[7-(trifluoromethoxy)-3,4-dihydro-2H-chromen-4-yl]urea.
| Compound Name | 1-(1H-indazol-4-yl)-3-[7-(trifluoromethoxy)-3,4-dihydro-2H-chromen-4-yl]urea |
|---|---|
| PubChem CID | 11654024 |
| Molecular Formula | C18H15F3N4O3 |
| Molecular Weight | 392.34 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 1-(1H-indazol-4-yl)-3-[7-(trifluoromethoxy)-3,4-dihydro-2H-chromen-4-yl]urea |
| SMILES | O=C(Nc1cccc2[nH]ncc12)NC1CCOc2cc(OC(F)(F)F)ccc21 |
| InChI | InChI=1S/C18H15F3N4O3/c19-18(20,21)28-10-4-5-11-14(6-7-27-16(11)8-10)24-17(26)23-13-2-1-3-15-12(13)9-22-25-15/h1-5,8-9,14H,6-7H2,(H,22,25)(H2,23,24,26) |
| InChIKey | CHVBTEZXWRYVOG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.34 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |