C18H15F3N4O2 — CID 11603236
1-(1H-indazol-4-yl)-3-[8-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-yl]urea (PubChem CID 11603236) has the molecular formula C18H15F3N4O2 and a molecular weight of 376.34 g/mol. Its IUPAC name is 1-(1H-indazol-4-yl)-3-[8-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-yl]urea.
| Compound Name | 1-(1H-indazol-4-yl)-3-[8-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-yl]urea |
|---|---|
| PubChem CID | 11603236 |
| Molecular Formula | C18H15F3N4O2 |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 1-(1H-indazol-4-yl)-3-[8-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-yl]urea |
| SMILES | O=C(Nc1cccc2[nH]ncc12)NC1CCOc2c1cccc2C(F)(F)F |
| InChI | InChI=1S/C18H15F3N4O2/c19-18(20,21)12-4-1-3-10-14(7-8-27-16(10)12)24-17(26)23-13-5-2-6-15-11(13)9-22-25-15/h1-6,9,14H,7-8H2,(H,22,25)(H2,23,24,26) |
| InChIKey | CRCCQJDITKRXDH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |