C25H31N5O2 — CID 11711740
1-[1-(cyclohexylmethyl)-6-methoxy-3,4-dihydro-2H-quinolin-4-yl]-3-(1H-indazol-4-yl)urea (PubChem CID 11711740) has the molecular formula C25H31N5O2 and a molecular weight of 433.56 g/mol. Its IUPAC name is 1-[1-(cyclohexylmethyl)-6-methoxy-3,4-dihydro-2H-quinolin-4-yl]-3-(1H-indazol-4-yl)urea.
| Compound Name | 1-[1-(cyclohexylmethyl)-6-methoxy-3,4-dihydro-2H-quinolin-4-yl]-3-(1H-indazol-4-yl)urea |
|---|---|
| PubChem CID | 11711740 |
| Molecular Formula | C25H31N5O2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 1-[1-(cyclohexylmethyl)-6-methoxy-3,4-dihydro-2H-quinolin-4-yl]-3-(1H-indazol-4-yl)urea |
| SMILES | COc1ccc2c(c1)C(NC(=O)Nc1cccc3[nH]ncc13)CCN2CC1CCCCC1 |
| InChI | InChI=1S/C25H31N5O2/c1-32-18-10-11-24-19(14-18)22(12-13-30(24)16-17-6-3-2-4-7-17)28-25(31)27-21-8-5-9-23-20(21)15-26-29-23/h5,8-11,14-15,17,22H,2-4,6-7,12-13,16H2,1H3,(H,26,29)(H2,27,28,31) |
| InChIKey | XFXAXIXVJKIEKT-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|