C18H18N6O — CID 112962410
N-[4-[[5-(N-methylanilino)-1,2,4-triazin-3-yl]amino]phenyl]acetamide (PubChem CID 112962410) has the molecular formula C18H18N6O and a molecular weight of 334.38 g/mol. Its IUPAC name is N-[4-[[5-(N-methylanilino)-1,2,4-triazin-3-yl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[5-(N-methylanilino)-1,2,4-triazin-3-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 112962410 |
| Molecular Formula | C18H18N6O |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | N-[4-[[5-(N-methylanilino)-1,2,4-triazin-3-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Nc2nncc(N(C)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C18H18N6O/c1-13(25)20-14-8-10-15(11-9-14)21-18-22-17(12-19-23-18)24(2)16-6-4-3-5-7-16/h3-12H,1-2H3,(H,20,25)(H,21,22,23) |
| InChIKey | QUVLYFXCEVTCKV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |