C19H19N5O — CID 112964447
1-[4-[[3-(N-ethylanilino)-1,2,4-triazin-5-yl]amino]phenyl]ethanone (PubChem CID 112964447) has the molecular formula C19H19N5O and a molecular weight of 333.40 g/mol. Its IUPAC name is 1-[4-[[3-(N-ethylanilino)-1,2,4-triazin-5-yl]amino]phenyl]ethanone.
| Compound Name | 1-[4-[[3-(N-ethylanilino)-1,2,4-triazin-5-yl]amino]phenyl]ethanone |
|---|---|
| PubChem CID | 112964447 |
| Molecular Formula | C19H19N5O |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 1-[4-[[3-(N-ethylanilino)-1,2,4-triazin-5-yl]amino]phenyl]ethanone |
| SMILES | CCN(c1ccccc1)c1nncc(Nc2ccc(C(C)=O)cc2)n1 |
| InChI | InChI=1S/C19H19N5O/c1-3-24(17-7-5-4-6-8-17)19-22-18(13-20-23-19)21-16-11-9-15(10-12-16)14(2)25/h4-13H,3H2,1-2H3,(H,21,22,23) |
| InChIKey | LSWZDEHRDCTRDR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |