C17H23N5O2 — CID 112960229
ethyl 4-[[3-[butyl(methyl)amino]-1,2,4-triazin-5-yl]amino]benzoate (PubChem CID 112960229) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is ethyl 4-[[3-[butyl(methyl)amino]-1,2,4-triazin-5-yl]amino]benzoate.
| Compound Name | ethyl 4-[[3-[butyl(methyl)amino]-1,2,4-triazin-5-yl]amino]benzoate |
|---|---|
| PubChem CID | 112960229 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | ethyl 4-[[3-[butyl(methyl)amino]-1,2,4-triazin-5-yl]amino]benzoate |
| SMILES | CCCCN(C)c1nncc(Nc2ccc(C(=O)OCC)cc2)n1 |
| InChI | InChI=1S/C17H23N5O2/c1-4-6-11-22(3)17-20-15(12-18-21-17)19-14-9-7-13(8-10-14)16(23)24-5-2/h7-10,12H,4-6,11H2,1-3H3,(H,19,20,21) |
| InChIKey | HWTUFKYUBDAIDW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |