About CID 11296696
CID 11296696 (PubChem CID 11296696) has the molecular formula C32H28F2NP2
and a molecular weight of 526.53 g/mol.
Molecular Properties
| Compound Name | CID 11296696 |
| PubChem CID | 11296696 |
| Molecular Formula | C32H28F2NP2 |
| Molecular Weight | 526.53 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | — |
| SMILES | C[C@H]([C]1[CH][CH][CH][C]1P(c1ccccc1)c1ccccc1)N(C)P(c1cccc(F)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C32H28F2NP2/c1-24(35(2)37(29-18-9-12-25(33)22-29)30-19-10-13-26(34)23-30)31-20-11-21-32(31)36(27-14-5-3-6-15-27)28-16-7-4-8-17-28/h3-24H,1-2H3/t24-/m1/s1 |
| InChIKey | NEXCDKWWKGQXPD-XMMPIXPASA-N |
| XLogP | 6.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 526.53 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 11296696 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11296696?
The IUPAC name of CID 11296696 (CID 11296696) is not available.
What is the SMILES notation for CID 11296696?
The canonical SMILES for CID 11296696 is C[C@H]([C]1[CH][CH][CH][C]1P(c1ccccc1)c1ccccc1)N(C)P(c1cccc(F)c1)c1cccc(F)c1.
What is the InChIKey of CID 11296696?
The InChIKey is NEXCDKWWKGQXPD-XMMPIXPASA-N. The full InChI is InChI=1S/C32H28F2NP2/c1-24(35(2)37(29-18-9-12-25(33)22-29)30-19-10-13-26(34)23-30)31-20-11-21-32(31)36(27-14-5-3-6-15-27)28-16-7-4-8-17-28/h3-24H,1-2H3/t24-/m1/s1.
What are the key properties of CID 11296696?
CID 11296696 has a molecular weight of 526.53 g/mol, XLogP of 6.50, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11296696 is sourced from PubChem (CID 11296696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).