About CID 11528005
CID 11528005 (PubChem CID 11528005) has the molecular formula C40H40N2P2
and a molecular weight of 610.72 g/mol.
Molecular Properties
| Compound Name | CID 11528005 |
| PubChem CID | 11528005 |
| Molecular Formula | C40H40N2P2 |
| Molecular Weight | 610.72 g/mol |
| Exact Mass | 610.27 |
| IUPAC Name | — |
| SMILES | C[C@H](NCCN[C@@H](C)[C]1[CH][CH][CH][C]1P(c1ccccc1)c1ccccc1)[C]1[CH][CH][CH][C]1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H40N2P2/c1-31(37-25-15-27-39(37)43(33-17-7-3-8-18-33)34-19-9-4-10-20-34)41-29-30-42-32(2)38-26-16-28-40(38)44(35-21-11-5-12-22-35)36-23-13-6-14-24-36/h3-28,31-32,41-42H,29-30H2,1-2H3/t31-,32-/m0/s1 |
| InChIKey | UIKLYTXSKGVPDG-ACHIHNKUSA-N |
| XLogP | 6.67 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 610.72 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 11528005 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11528005?
The IUPAC name of CID 11528005 (CID 11528005) is not available.
What is the SMILES notation for CID 11528005?
The canonical SMILES for CID 11528005 is C[C@H](NCCN[C@@H](C)[C]1[CH][CH][CH][C]1P(c1ccccc1)c1ccccc1)[C]1[CH][CH][CH][C]1P(c1ccccc1)c1ccccc1.
What is the InChIKey of CID 11528005?
The InChIKey is UIKLYTXSKGVPDG-ACHIHNKUSA-N. The full InChI is InChI=1S/C40H40N2P2/c1-31(37-25-15-27-39(37)43(33-17-7-3-8-18-33)34-19-9-4-10-20-34)41-29-30-42-32(2)38-26-16-28-40(38)44(35-21-11-5-12-22-35)36-23-13-6-14-24-36/h3-28,31-32,41-42H,29-30H2,1-2H3/t31-,32-/m0/s1.
What are the key properties of CID 11528005?
CID 11528005 has a molecular weight of 610.72 g/mol, XLogP of 6.67, 13 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11528005 is sourced from PubChem (CID 11528005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).