About CID 135774007
CID 135774007 (PubChem CID 135774007) has the molecular formula C32H30NO2P2
and a molecular weight of 522.55 g/mol.
Molecular Properties
| Compound Name | CID 135774007 |
| PubChem CID | 135774007 |
| Molecular Formula | C32H30NO2P2 |
| Molecular Weight | 522.55 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | — |
| SMILES | C[C@@H]([C]1[CH][CH][CH][C]1P(c1ccccc1)c1ccccc1)N(C)P(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C32H30NO2P2/c1-26(33(2)37(34-27-16-7-3-8-17-27)35-28-18-9-4-10-19-28)31-24-15-25-32(31)36(29-20-11-5-12-21-29)30-22-13-6-14-23-30/h3-26H,1-2H3/t26-/m0/s1 |
| InChIKey | KILZFZMTIGCIFI-SANMLTNESA-N |
| XLogP | 7.56 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 522.55 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 135774007 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 135774007?
The IUPAC name of CID 135774007 (CID 135774007) is not available.
What is the SMILES notation for CID 135774007?
The canonical SMILES for CID 135774007 is C[C@@H]([C]1[CH][CH][CH][C]1P(c1ccccc1)c1ccccc1)N(C)P(Oc1ccccc1)Oc1ccccc1.
What is the InChIKey of CID 135774007?
The InChIKey is KILZFZMTIGCIFI-SANMLTNESA-N. The full InChI is InChI=1S/C32H30NO2P2/c1-26(33(2)37(34-27-16-7-3-8-17-27)35-28-18-9-4-10-19-28)31-24-15-25-32(31)36(29-20-11-5-12-21-29)30-22-13-6-14-23-30/h3-26H,1-2H3/t26-/m0/s1.
What are the key properties of CID 135774007?
CID 135774007 has a molecular weight of 522.55 g/mol, XLogP of 7.56, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 135774007 is sourced from PubChem (CID 135774007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).