About CID 10942070
CID 10942070 (PubChem CID 10942070) has the molecular formula C26H25NP
and a molecular weight of 382.47 g/mol.
Molecular Properties
| Compound Name | CID 10942070 |
| PubChem CID | 10942070 |
| Molecular Formula | C26H25NP |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | — |
| SMILES | CN(C)[C@@H]([C]1[CH][CH][CH][C]1P(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H25NP/c1-27(2)26(21-13-6-3-7-14-21)24-19-12-20-25(24)28(22-15-8-4-9-16-22)23-17-10-5-11-18-23/h3-20,26H,1-2H3/t26-/m1/s1 |
| InChIKey | XGEPNGYYHLHUEJ-AREMUKBSSA-N |
| XLogP | 5.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 10942070 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10942070?
The IUPAC name of CID 10942070 (CID 10942070) is not available.
What is the SMILES notation for CID 10942070?
The canonical SMILES for CID 10942070 is CN(C)[C@@H]([C]1[CH][CH][CH][C]1P(c1ccccc1)c1ccccc1)c1ccccc1.
What is the InChIKey of CID 10942070?
The InChIKey is XGEPNGYYHLHUEJ-AREMUKBSSA-N. The full InChI is InChI=1S/C26H25NP/c1-27(2)26(21-13-6-3-7-14-21)24-19-12-20-25(24)28(22-15-8-4-9-16-22)23-17-10-5-11-18-23/h3-20,26H,1-2H3/t26-/m1/s1.
What are the key properties of CID 10942070?
CID 10942070 has a molecular weight of 382.47 g/mol, XLogP of 5.16, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10942070 is sourced from PubChem (CID 10942070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).