C33H32FeNOP — CID 166444081
CID 166444081 (PubChem CID 166444081) has the molecular formula C33H32FeNOP and a molecular weight of 545.44 g/mol.
| Compound Name | CID 166444081 |
|---|---|
| PubChem CID | 166444081 |
| Molecular Formula | C33H32FeNOP |
| Molecular Weight | 545.44 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | — |
| SMILES | C[C@H](N[C@H]1c2ccccc2C[C@H]1O)[C]1[CH][CH][CH][C]1P(c1ccccc1)c1ccccc1.[CH]1[CH][CH][CH][CH]1.[Fe] |
| InChI | InChI=1S/C28H27NOP.C5H5.Fe/c1-20(29-28-25-16-9-8-11-21(25)19-26(28)30)24-17-10-18-27(24)31(22-12-4-2-5-13-22)23-14-6-3-7-15-23;1-2-4-5-3-1;/h2-18,20,26,28-30H,19H2,1H3;1-5H;/t20-,26+,28-;;/m0../s1 |
| InChIKey | CJBJUMYDAGHNGD-MGYQTVKMSA-N |
| XLogP | 5.51 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.44 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|