C29H29N2OPS — CID 118687883
1-[(1R)-1-(2-diphenylphosphanylcyclopenta-1,3-dien-1-yl)ethyl]-3-[(1S,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]thiourea (PubChem CID 118687883) has the molecular formula C29H29N2OPS and a molecular weight of 484.61 g/mol. Its IUPAC name is 1-[(1R)-1-(2-diphenylphosphanylcyclopenta-1,3-dien-1-yl)ethyl]-3-[(1S,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]thiourea.
| Compound Name | 1-[(1R)-1-(2-diphenylphosphanylcyclopenta-1,3-dien-1-yl)ethyl]-3-[(1S,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]thiourea |
|---|---|
| PubChem CID | 118687883 |
| Molecular Formula | C29H29N2OPS |
| Molecular Weight | 484.61 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 1-[(1R)-1-(2-diphenylphosphanylcyclopenta-1,3-dien-1-yl)ethyl]-3-[(1S,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]thiourea |
| SMILES | C[C@@H](NC(=S)N[C@H]1c2ccccc2C[C@@H]1O)C1=C(P(c2ccccc2)c2ccccc2)C=CC1 |
| InChI | InChI=1S/C29H29N2OPS/c1-20(30-29(34)31-28-25-16-9-8-11-21(25)19-26(28)32)24-17-10-18-27(24)33(22-12-4-2-5-13-22)23-14-6-3-7-15-23/h2-16,18,20,26,28,32H,17,19H2,1H3,(H2,30,31,34)/t20-,26+,28+/m1/s1 |
| InChIKey | IBLLUALLQMVLIO-PBZMZIQDSA-N |
| XLogP | 4.84 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.61 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|