C30H35N2OPS — CID 130368285
1-[(1R)-1-[(1S)-2-diphenylphosphanyl-2-methylcyclopentyl]ethyl]-3-[(1S,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]thiourea (PubChem CID 130368285) has the molecular formula C30H35N2OPS and a molecular weight of 502.66 g/mol. Its IUPAC name is 1-[(1R)-1-[(1S)-2-diphenylphosphanyl-2-methylcyclopentyl]ethyl]-3-[(1S,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]thiourea.
| Compound Name | 1-[(1R)-1-[(1S)-2-diphenylphosphanyl-2-methylcyclopentyl]ethyl]-3-[(1S,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]thiourea |
|---|---|
| PubChem CID | 130368285 |
| Molecular Formula | C30H35N2OPS |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | 1-[(1R)-1-[(1S)-2-diphenylphosphanyl-2-methylcyclopentyl]ethyl]-3-[(1S,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]thiourea |
| SMILES | C[C@@H](NC(=S)N[C@H]1c2ccccc2C[C@@H]1O)[C@@H]1CCCC1(C)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H35N2OPS/c1-21(31-29(35)32-28-25-17-10-9-12-22(25)20-27(28)33)26-18-11-19-30(26,2)34(23-13-5-3-6-14-23)24-15-7-4-8-16-24/h3-10,12-17,21,26-28,33H,11,18-20H2,1-2H3,(H2,31,32,35)/t21-,26+,27+,28+,30?/m1/s1 |
| InChIKey | KGSBJMKXZHGTCP-RKWHHYMCSA-N |
| XLogP | 5.19 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|