C19H23ClN2O3 — CID 112989711
N-[4-(4-chloro-2,5-dimethoxyanilino)phenyl]-2,2-dimethylpropanamide (PubChem CID 112989711) has the molecular formula C19H23ClN2O3 and a molecular weight of 362.86 g/mol. Its IUPAC name is N-[4-(4-chloro-2,5-dimethoxyanilino)phenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-(4-chloro-2,5-dimethoxyanilino)phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 112989711 |
| Molecular Formula | C19H23ClN2O3 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | N-[4-(4-chloro-2,5-dimethoxyanilino)phenyl]-2,2-dimethylpropanamide |
| SMILES | COc1cc(Nc2ccc(NC(=O)C(C)(C)C)cc2)c(OC)cc1Cl |
| InChI | InChI=1S/C19H23ClN2O3/c1-19(2,3)18(23)22-13-8-6-12(7-9-13)21-15-11-16(24-4)14(20)10-17(15)25-5/h6-11,21H,1-5H3,(H,22,23) |
| InChIKey | FUFLOYCNBHXPJP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |