C18H20O2 — CID 11300160
(2R,4aS)-2-cyclohexyl-2,4a-dihydrobenzo[f][1,2]benzodioxine (PubChem CID 11300160) has the molecular formula C18H20O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is (2R,4aS)-2-cyclohexyl-2,4a-dihydrobenzo[f][1,2]benzodioxine.
| Compound Name | (2R,4aS)-2-cyclohexyl-2,4a-dihydrobenzo[f][1,2]benzodioxine |
|---|---|
| PubChem CID | 11300160 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | (2R,4aS)-2-cyclohexyl-2,4a-dihydrobenzo[f][1,2]benzodioxine |
| SMILES | C1=C[C@@H]2OO[C@H](C3CCCCC3)C=C2c2ccccc21 |
| InChI | InChI=1S/C18H20O2/c1-2-7-14(8-3-1)18-12-16-15-9-5-4-6-13(15)10-11-17(16)19-20-18/h4-6,9-12,14,17-18H,1-3,7-8H2/t17-,18-/m0/s1 |
| InChIKey | MSMRCLBTHIKWIB-ROUUACIJSA-N |
| XLogP | 4.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|