C14H14N2O — CID 20641425
(3R)-3-amino-2,3,5,5a-tetrahydrobenzo[g][1]benzazepin-4-one (PubChem CID 20641425) has the molecular formula C14H14N2O and a molecular weight of 226.28 g/mol. Its IUPAC name is (3R)-3-amino-2,3,5,5a-tetrahydrobenzo[g][1]benzazepin-4-one.
| Compound Name | (3R)-3-amino-2,3,5,5a-tetrahydrobenzo[g][1]benzazepin-4-one |
|---|---|
| PubChem CID | 20641425 |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | (3R)-3-amino-2,3,5,5a-tetrahydrobenzo[g][1]benzazepin-4-one |
| SMILES | N[C@@H]1CC=C2c3ccccc3C=CC2NC1=O |
| InChI | InChI=1S/C14H14N2O/c15-12-7-6-11-10-4-2-1-3-9(10)5-8-13(11)16-14(12)17/h1-6,8,12-13H,7,15H2,(H,16,17)/t12-,13?/m1/s1 |
| InChIKey | NALNUNGMGHIDTM-PZORYLMUSA-N |
| XLogP | 1.31 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |