C14H11NO2 — CID 57182742
7-azatricyclo[9.4.0.03,8]pentadeca-1(15),4,9,11,13-pentaene-2,6-dione (PubChem CID 57182742) has the molecular formula C14H11NO2 and a molecular weight of 225.25 g/mol. Its IUPAC name is 7-azatricyclo[9.4.0.03,8]pentadeca-1(15),4,9,11,13-pentaene-2,6-dione.
| Compound Name | 7-azatricyclo[9.4.0.03,8]pentadeca-1(15),4,9,11,13-pentaene-2,6-dione |
|---|---|
| PubChem CID | 57182742 |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 7-azatricyclo[9.4.0.03,8]pentadeca-1(15),4,9,11,13-pentaene-2,6-dione |
| SMILES | O=C1C=CC2C(=O)c3ccccc3C=CC2N1 |
| InChI | InChI=1S/C14H11NO2/c16-13-8-6-11-12(15-13)7-5-9-3-1-2-4-10(9)14(11)17/h1-8,11-12H,(H,15,16) |
| InChIKey | LDQKOERWZWHNJP-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |