C17H31NO3Si — CID 11301807
ethyl 2-[[(1S,2S,5S)-2,6,6-trimethyl-2-trimethylsilyloxy-3-bicyclo[3.1.1]heptanylidene]amino]acetate (PubChem CID 11301807) has the molecular formula C17H31NO3Si and a molecular weight of 325.53 g/mol. Its IUPAC name is ethyl 2-[[(1S,2S,5S)-2,6,6-trimethyl-2-trimethylsilyloxy-3-bicyclo[3.1.1]heptanylidene]amino]acetate.
| Compound Name | ethyl 2-[[(1S,2S,5S)-2,6,6-trimethyl-2-trimethylsilyloxy-3-bicyclo[3.1.1]heptanylidene]amino]acetate |
|---|---|
| PubChem CID | 11301807 |
| Molecular Formula | C17H31NO3Si |
| Molecular Weight | 325.53 g/mol |
| Exact Mass | 325.21 |
| IUPAC Name | ethyl 2-[[(1S,2S,5S)-2,6,6-trimethyl-2-trimethylsilyloxy-3-bicyclo[3.1.1]heptanylidene]amino]acetate |
| SMILES | CCOC(=O)C/N=C1\C[C@@H]2C[C@@H](C2(C)C)[C@]1(C)O[Si](C)(C)C |
| InChI | InChI=1S/C17H31NO3Si/c1-8-20-15(19)11-18-14-10-12-9-13(16(12,2)3)17(14,4)21-22(5,6)7/h12-13H,8-11H2,1-7H3/b18-14+/t12-,13-,17-/m0/s1 |
| InChIKey | POJHMQKYWLBQHA-SYZLFOQYSA-N |
| XLogP | 3.67 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.53 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|