C20H17N3OS — CID 11302447
N-ethyl-N,3-diphenyl-2H-thieno[2,3-c]pyrazole-5-carboxamide (PubChem CID 11302447) has the molecular formula C20H17N3OS and a molecular weight of 347.44 g/mol. Its IUPAC name is N-ethyl-N,3-diphenyl-2H-thieno[2,3-c]pyrazole-5-carboxamide.
| Compound Name | N-ethyl-N,3-diphenyl-2H-thieno[2,3-c]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 11302447 |
| Molecular Formula | C20H17N3OS |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | N-ethyl-N,3-diphenyl-2H-thieno[2,3-c]pyrazole-5-carboxamide |
| SMILES | CCN(C(=O)c1cc2c(-c3ccccc3)[nH]nc2s1)c1ccccc1 |
| InChI | InChI=1S/C20H17N3OS/c1-2-23(15-11-7-4-8-12-15)20(24)17-13-16-18(21-22-19(16)25-17)14-9-5-3-6-10-14/h3-13H,2H2,1H3,(H,21,22) |
| InChIKey | CYYFJXBURTYJHB-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |