C19H21ClN2O3 — CID 11302881
methyl (6aR,9R)-7-(3-chloropropanoyl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxylate (PubChem CID 11302881) has the molecular formula C19H21ClN2O3 and a molecular weight of 360.84 g/mol. Its IUPAC name is methyl (6aR,9R)-7-(3-chloropropanoyl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxylate.
| Compound Name | methyl (6aR,9R)-7-(3-chloropropanoyl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxylate |
|---|---|
| PubChem CID | 11302881 |
| Molecular Formula | C19H21ClN2O3 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | methyl (6aR,9R)-7-(3-chloropropanoyl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxylate |
| SMILES | COC(=O)[C@@H]1CC2c3cccc4[nH]cc(c34)C[C@H]2N(C(=O)CCCl)C1 |
| InChI | InChI=1S/C19H21ClN2O3/c1-25-19(24)12-7-14-13-3-2-4-15-18(13)11(9-21-15)8-16(14)22(10-12)17(23)5-6-20/h2-4,9,12,14,16,21H,5-8,10H2,1H3/t12-,14?,16-/m1/s1 |
| InChIKey | LIIZXAIVCKHCGM-QXDOLYAVSA-N |
| XLogP | 2.83 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|