C23H27N3O — CID 11302909
3-[1-[2-(3-cyanophenyl)ethyl]-3,4-dimethylpiperidin-4-yl]benzamide (PubChem CID 11302909) has the molecular formula C23H27N3O and a molecular weight of 361.49 g/mol. Its IUPAC name is 3-[1-[2-(3-cyanophenyl)ethyl]-3,4-dimethylpiperidin-4-yl]benzamide.
| Compound Name | 3-[1-[2-(3-cyanophenyl)ethyl]-3,4-dimethylpiperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 11302909 |
| Molecular Formula | C23H27N3O |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 3-[1-[2-(3-cyanophenyl)ethyl]-3,4-dimethylpiperidin-4-yl]benzamide |
| SMILES | CC1CN(CCc2cccc(C#N)c2)CCC1(C)c1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C23H27N3O/c1-17-16-26(11-9-18-5-3-6-19(13-18)15-24)12-10-23(17,2)21-8-4-7-20(14-21)22(25)27/h3-8,13-14,17H,9-12,16H2,1-2H3,(H2,25,27) |
| InChIKey | ORCPMSHSNBDPPE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |